Benzenepropanoic acid, 4-chloro-.alpha.- (diethoxyphosphinyl)-, ethyl ester
Modify Date: 2025-09-20 14:24:30
Benzenepropanoic acid, 4-chloro-.alpha.- (diethoxyphosphinyl)-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, 4-chloro-.alpha.- (diethoxyphosphinyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 35085-34-8 | Molecular Weight | 348.75900 | |
| Density | 1.2g/cm3 | Boiling Point | 443.8ºC at 760 mmHg | |
| Molecular Formula | C15H22ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.1ºC | |
| Name | ethyl 3-(4-chlorophenyl)-2-diethoxyphosphorylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 443.8ºC at 760 mmHg |
| Molecular Formula | C15H22ClO5P |
| Molecular Weight | 348.75900 |
| Flash Point | 360.1ºC |
| Exact Mass | 348.08900 |
| PSA | 71.64000 |
| LogP | 4.08030 |
| Index of Refraction | 1.498 |
| InChIKey | VHFAWKBEYCWBFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(Cl)cc1)P(=O)(OCC)OCC |
| HS Code | 2931900090 |
|---|
|
~45%
Benzenepropanoi... CAS#:35085-34-8 |
| Literature: ZAMBON GROUP S.p.A. Patent: EP636621 A1, 1995 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ethyl 3-(4-chlorophenyl)-2-(diethoxyphosphoryl)propanoate |
| ethyl 3-(4-chlorophenyl)-2-diethoxyphosphinyl-propionate |
| benzenepropanoic acid,4-chloro-|A-(diethoxyphosphinyl)-,ethyl ester |