1-Chloro-2-(dichlorophenylmethyl)benzene structure
|
Common Name | 1-Chloro-2-(dichlorophenylmethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 3509-85-1 | Molecular Weight | 271.570 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 359.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C13H9Cl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.3±22.1 °C | |
| Name | 1-chloro-2-[dichloro(phenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.1±37.0 °C at 760 mmHg |
| Molecular Formula | C13H9Cl3 |
| Molecular Weight | 271.570 |
| Flash Point | 249.3±22.1 °C |
| Exact Mass | 269.976990 |
| LogP | 4.84 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | PHRLCYSMTGTXMM-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1C(Cl)(Cl)c1ccccc1 |
| HS Code | 2903999090 |
|---|
|
~96%
1-Chloro-2-(dic... CAS#:3509-85-1 |
| Literature: Ramchandani; Wakharkar; Sudalai Tetrahedron Letters, 1996 , vol. 37, # 23 p. 4063 - 4064 |
|
~%
1-Chloro-2-(dic... CAS#:3509-85-1 |
| Literature: Lee, Tae-Kyung; Ryoo, Sun-Jong; Lee, Yoon-Sik Tetrahedron Letters, 2007 , vol. 48, # 3 p. 389 - 391 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-diphenyldichloromethane |
| 2-Chlor-benzhydrylidendichlorid |
| Benzene, 1-chloro-2-(dichlorophenylmethyl)- |
| 1-Chloro-2-[dichloro(phenyl)methyl]benzene |
| Clotrimazole Impurity 9 |