2-benzoyl-6,7-dimethoxy-1H-isoquinoline-1-carbonitrile structure
|
Common Name | 2-benzoyl-6,7-dimethoxy-1H-isoquinoline-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 35096-40-3 | Molecular Weight | 320.34200 | |
| Density | 1.29g/cm3 | Boiling Point | 559.6ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.3ºC | |
| Name | 2-benzoyl-6,7-dimethoxy-1H-isoquinoline-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 559.6ºC at 760 mmHg |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.34200 |
| Flash Point | 292.3ºC |
| Exact Mass | 320.11600 |
| PSA | 62.56000 |
| LogP | 3.33308 |
| Index of Refraction | 1.638 |
| InChIKey | XKGZIADZUWYMKL-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(C#N)N(C(=O)c1ccccc1)C=C2 |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
| HMS1548P11 |
| 2-benzoyl-1-cyano-6,7-dimethoxy-1,2-dihydroisoquinoline |
| 2-Benzoyl-6,7-dimethoxy-1,2-dihydro-1-isoquinolinecarbonitrile |
| 6,7-dimethoxy-Reissert compound |
| InChI=1/C19H16N2O3/c1-23-17-10-14-8-9-21(19(22)13-6-4-3-5-7-13)16(12-20)15(14)11-18(17)24-2/h3-11,16H,1-2H |
| 1-Cyano-2-benzoyl-6,7-dimethoxyisoquinoline |
| 2-Benzoyl-1-cyan-6,7-dimethoxy-1,2-dihydroisochinolin |
| N-Benzoyl-1-cyano-1,2-dihydro-6,7-dimethoxyisochinolin |
| 2-benzoyl-1,2-dihydro-6,7-dimethoxyisoquinoline-1-carbonitrile |