1,2-bis[3-(trifluoromethyl)phenyl]hydrazine structure
|
Common Name | 1,2-bis[3-(trifluoromethyl)phenyl]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 351-19-9 | Molecular Weight | 320.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F6N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis[3-(trifluoromethyl)phenyl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10F6N2 |
|---|---|
| Molecular Weight | 320.23300 |
| Exact Mass | 320.07500 |
| PSA | 24.06000 |
| LogP | 5.30920 |
| InChIKey | WTUBIIQFZWOLMV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(NNc2cccc(C(F)(F)F)c2)c1 |
| HS Code | 2928000090 |
|---|
|
~96%
1,2-bis[3-(trif... CAS#:351-19-9 |
| Literature: AIR WATER INC. Patent: US2009/69602 A1, 2009 ; Location in patent: Page/Page column 2 ; |
|
~93%
1,2-bis[3-(trif... CAS#:351-19-9 |
| Literature: Ung, Stephane; Falguieres, Annie; Guy, Alain; Ferroud, Clotilde Tetrahedron Letters, 2005 , vol. 46, # 35 p. 5913 - 5917 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,3'-trifluoromethylhydrazobenzene |
| 3,3'-ditrifluoromethylhydrazobenzene |
| 3,3'-Bis-trifluormethyl-hydrazobenzol |