3-(6-CHLORO-2H-1,4-BENZOXAZIN-3(4H)-ONE-4-YL)PROPIONICACID structure
|
Common Name | 3-(6-CHLORO-2H-1,4-BENZOXAZIN-3(4H)-ONE-4-YL)PROPIONICACID | ||
|---|---|---|---|---|
| CAS Number | 351003-03-7 | Molecular Weight | 255.65400 | |
| Density | 1.456g/cm3 | Boiling Point | 569.9ºC at 760mmHg | |
| Molecular Formula | C11H10ClNO4 | Melting Point | 146-149ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 298.4ºC | |
| Name | 3-(6-Chloro-3-oxo-2,3-dihydro-benzo[1,4]oxazin-4-yl)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 569.9ºC at 760mmHg |
| Melting Point | 146-149ºC(lit.) |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.65400 |
| Flash Point | 298.4ºC |
| Exact Mass | 255.03000 |
| PSA | 66.84000 |
| LogP | 1.60510 |
| Index of Refraction | 1.593 |
| InChIKey | REQQIWCFXWGLDY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCN1C(=O)COc2ccc(Cl)cc21 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chloro-2,3-dihydro-3-oxo-4H-1,4-benzoxazine-4-propionic acid |
| 3-(6-CHLORO-2H-1,4-BENZOXAZIN-3(4H)-ONE |
| MFCD03093932 |
| 6-Chloro-2,3-dihydro-3-oxo-4H-1,4-benzoxazine-4-propanoic acid |