4-ETHOXY-2' 3' 4' 5' 6'-PENTAFLUOROBENZ& structure
|
Common Name | 4-ETHOXY-2' 3' 4' 5' 6'-PENTAFLUOROBENZ& | ||
|---|---|---|---|---|
| CAS Number | 351003-31-1 | Molecular Weight | 316.22300 | |
| Density | 1.38g/cm3 | Boiling Point | 391.7ºC at 760mmHg | |
| Molecular Formula | C15H9F5O2 | Melting Point | 48-52ºC(lit.) | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | (4-ethoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 391.7ºC at 760mmHg |
| Melting Point | 48-52ºC(lit.) |
| Molecular Formula | C15H9F5O2 |
| Molecular Weight | 316.22300 |
| Flash Point | 184.1ºC |
| Exact Mass | 316.05200 |
| PSA | 26.30000 |
| LogP | 4.01180 |
| Index of Refraction | 1.499 |
| InChIKey | YZUXMWWGIFJHOY-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Ethoxy-2',3',4',5',6'-pentafluorobenzophenone |