pentachlorophenol, compound with [1R-(1alpha,4abeta,10aalpha)]-1,2,3,4,4a,9,10,10a-octahydro-7-isopropyl-1,4a-dimethylphenanthrene-1-methylamine (1:1) structure
|
Common Name | pentachlorophenol, compound with [1R-(1alpha,4abeta,10aalpha)]-1,2,3,4,4a,9,10,10a-octahydro-7-isopropyl-1,4a-dimethylphenanthrene-1-methylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 35109-57-0 | Molecular Weight | 551.803 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H32Cl5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dehydroabietylammonium pentachlorophenoxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H32Cl5NO |
|---|---|
| Molecular Weight | 551.803 |
| Exact Mass | 549.092651 |
| InChIKey | FQHFSZCYOUJICQ-WFBUOHSLSA-N |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(CN)CCCC21C.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| Phenol, 2,3,4,5,6-pentachloro-, compd. with (1R,4aS,10aR)-1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenemethanamine (1:1) |
| EINECS 252-371-5 |
| Pentachlorophenol - abieta-8(14),9(11),12-trien-18-amine (1:1) |
| Dehydroabietylammonium pentachlorophenoxide |