1,3,5-tribromo-2-(2,3-dibromopropoxy)benzene structure
|
Common Name | 1,3,5-tribromo-2-(2,3-dibromopropoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 35109-60-5 | Molecular Weight | 530.67100 | |
| Density | 2.393g/cm3 | Boiling Point | 446.6ºC at 760mmHg | |
| Molecular Formula | C9H7Br5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.6ºC | |
| Name | 1,3,5-tribromo-2-(2,3-dibromopropoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.393g/cm3 |
|---|---|
| Boiling Point | 446.6ºC at 760mmHg |
| Molecular Formula | C9H7Br5O |
| Molecular Weight | 530.67100 |
| Flash Point | 185.6ºC |
| Exact Mass | 525.64100 |
| PSA | 9.23000 |
| LogP | 5.51130 |
| Index of Refraction | 1.648 |
| InChIKey | QXWYPAKUEHGJSG-UHFFFAOYSA-N |
| SMILES | BrCC(Br)COc1c(Br)cc(Br)cc1Br |
| HS Code | 2909309090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1,3,5-tribromo-2-(2,3-dibromopropoxy) |
| Propane,1-(2,4,6-tribromophenoxy)-2,3-dibromo |
| (+-)-2.3-Dibrom-1-(2.4.6-tribrom-phenoxy)-propan |
| (+-)-2.4.6-Tribrom-1-(2.3-dibrom-propyloxy)-benzol |
| 2,3-Dibromopropyl 2,4,6-tribromophenyl ether |
| (2,3-Dibrom-propyl)-(2,4,6-tribrom-phenyl)-aether |
| 1-(2,3-dibromo-propoxy)-2,4,6-tribromo-benzene |
| Bromkal 73-5PE |