2-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)propan-1-ol
Modify Date: 2025-11-25 15:52:28
2-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)propan-1-ol structure
|
Common Name | 2-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 35133-55-2 | Molecular Weight | 339.47100 | |
| Density | 1.091g/cm3 | Boiling Point | 486ºC at 760 mmHg | |
| Molecular Formula | C22H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 2-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 486ºC at 760 mmHg |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.47100 |
| Flash Point | 247.7ºC |
| Exact Mass | 339.22000 |
| PSA | 32.70000 |
| LogP | 4.00970 |
| Index of Refraction | 1.572 |
| InChIKey | DARNSYDCMZJMSF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)C(C)N2CCC(Cc3ccccc3)CC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| rc 61-96 |