2-[4-(cyclohexylmethyl)piperidin-1-yl]-1-(4-methoxyphenyl)propan-1-ol
Modify Date: 2024-01-31 20:17:29
![2-[4-(cyclohexylmethyl)piperidin-1-yl]-1-(4-methoxyphenyl)propan-1-ol Structure](https://image.chemsrc.com/caspic/409/35133-58-5.png)
2-[4-(cyclohexylmethyl)piperidin-1-yl]-1-(4-methoxyphenyl)propan-1-ol structure
|
Common Name | 2-[4-(cyclohexylmethyl)piperidin-1-yl]-1-(4-methoxyphenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 35133-58-5 | Molecular Weight | 345.51900 | |
| Density | 1.038g/cm3 | Boiling Point | 480.2ºC at 760 mmHg | |
| Molecular Formula | C22H35NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.2ºC | |
| Name | 2-[4-(cyclohexylmethyl)piperidin-1-yl]-1-(4-methoxyphenyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 480.2ºC at 760 mmHg |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.51900 |
| Flash Point | 244.2ºC |
| Exact Mass | 345.26700 |
| PSA | 32.70000 |
| LogP | 4.73740 |
| Index of Refraction | 1.534 |
| InChIKey | PMFSILGONBPGOX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)C(C)N2CCC(CC3CCCCC3)CC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| rc 72-01 |