2-[(3-fluoro-4-nitro-benzoyl)amino]pentanedioic acid
Modify Date: 2025-11-24 16:44:27
![2-[(3-fluoro-4-nitro-benzoyl)amino]pentanedioic acid Structure](https://image.chemsrc.com/caspic/324/3514-07-6.png)
2-[(3-fluoro-4-nitro-benzoyl)amino]pentanedioic acid structure
|
Common Name | 2-[(3-fluoro-4-nitro-benzoyl)amino]pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 3514-07-6 | Molecular Weight | 314.22300 | |
| Density | 1.559g/cm3 | Boiling Point | 587.4ºC at 760 mmHg | |
| Molecular Formula | C12H11FN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.1ºC | |
| Name | 3-Acetamino-1-ethyl-benzol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 587.4ºC at 760 mmHg |
| Molecular Formula | C12H11FN2O7 |
| Molecular Weight | 314.22300 |
| Flash Point | 309.1ºC |
| Exact Mass | 314.05500 |
| PSA | 149.52000 |
| LogP | 1.69580 |
| Index of Refraction | 1.59 |
| InChIKey | SMODRRRKMBKNDH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(NC(=O)c1ccc([N+](=O)[O-])c(F)c1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-acetylamino-1-ethylbenzene |
| 3-acetamido-ethylbenzol |