6-[3-(Dimethylamino)propoxy]-1-methyl-3H-benzofuro[2,3-f][1]benzopyran-3-one
Modify Date: 2025-09-10 16:55:19
![6-[3-(Dimethylamino)propoxy]-1-methyl-3H-benzofuro[2,3-f][1]benzopyran-3-one Structure](https://www.chemsrc.com/extcaspic/435/351902-90-4.png)
6-[3-(Dimethylamino)propoxy]-1-methyl-3H-benzofuro[2,3-f][1]benzopyran-3-one structure
|
Common Name | 6-[3-(Dimethylamino)propoxy]-1-methyl-3H-benzofuro[2,3-f][1]benzopyran-3-one | ||
|---|---|---|---|---|
| CAS Number | 351902-90-4 | Molecular Weight | 351.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[3-(Dimethylamino)propoxy]-1-methyl-3H-benzofuro[2,3-f][1]benzopyran-3-one |
|---|
| Molecular Formula | C21H21NO4 |
|---|---|
| Molecular Weight | 351.4 |
| InChIKey | AVEURCNPMXFXGN-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(OCCCN(C)C)c3c4ccccc4oc3c12 |
|
Name: Phototoxicity in albino Dunkin-Hartley guinea pig skin assessed as formation of eryth...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL869060
|
|
Name: Phototoxicity in albino Dunkin-Hartley guinea pig skin assessed as formation of eryth...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL869063
|
|
Name: Inhibition of topoisomerase 2 by ATP-dependent decatenation of kinetoplast DNA
Source: ChEMBL
Target: DNA topoisomerase 2-beta
External Id: CHEMBL869064
|
Total 3, Current Page 1 of 1
1