3-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzoic acid
Modify Date: 2024-01-25 19:40:29
![3-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzoic acid Structure](https://image.chemsrc.com/caspic/087/35195-78-9.png)
3-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzoic acid structure
|
Common Name | 3-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35195-78-9 | Molecular Weight | 315.77400 | |
| Density | 1.389g/cm3 | Boiling Point | 550.4ºC at 760 mmHg | |
| Molecular Formula | C16H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.6ºC | |
| Name | 3-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
|---|
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 550.4ºC at 760 mmHg |
| Molecular Formula | C16H10ClNO2S |
| Molecular Weight | 315.77400 |
| Flash Point | 286.6ºC |
| Exact Mass | 315.01200 |
| PSA | 78.43000 |
| LogP | 4.82870 |
| Index of Refraction | 1.658 |
| InChIKey | YKMSZGUJLCJGLR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2nc(-c3ccc(Cl)cc3)cs2)c1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |