6-(propan-2-ylamino)-1H-1,3,5-triazine-2,4-dione structure
|
Common Name | 6-(propan-2-ylamino)-1H-1,3,5-triazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 35200-63-6 | Molecular Weight | 170.16900 | |
| Density | 1.51g/cm3 | Boiling Point | 468.7ºC at 760mmHg | |
| Molecular Formula | C6H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.2ºC | |
| Name | N-isopropylammelide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 468.7ºC at 760mmHg |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.16900 |
| Flash Point | 237.2ºC |
| Exact Mass | 170.08000 |
| PSA | 94.39000 |
| Index of Refraction | 1.655 |
| InChIKey | DBFMBHXVWIURSV-UHFFFAOYSA-N |
| SMILES | CC(C)Nc1nc(=O)[nH]c(=O)[nH]1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-(propan-2-ylamino)-1H-1,3,5-triazine-2,4-dione |
| OOIT |
| N-Isopropylammelide |
| 2.4-Dihydroxy-6-isopropylamino-s-triazin |