N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide
Modify Date: 2026-06-15 17:40:37
N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide structure
|
Common Name | N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 352011-69-9 | Molecular Weight | 237.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15N3O3 |
|---|---|
| Molecular Weight | 237.25 |
| InChIKey | NOMDPEGQPXTVKP-UHFFFAOYSA-N |
| SMILES | COCCNC(=O)C(=O)NCC1=CC=CC=N1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide? |
| A: SMILES notation of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide is COCCNC(=O)C(=O)NCC1=CC=CC=N1. |
| Q: What is the English name of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide? |
| A: The English name of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide is N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide. |
| Q: What is the CAS number of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide? |
| A: CAS number of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide is 352011-69-9. |
| Q: What is the molecular weight of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide? |
| A: Molecular weight of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide is 237.25. |
| Q: What is the InChIKey of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide? |
| A: InChIKey of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide is NOMDPEGQPXTVKP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide? |
| A: Molecular formula of N-(2-methoxyethyl)-N'-(pyridin-2-ylmethyl)oxamide is C11H15N3O3. |
| Q: What is the Chinese name of 352011-69-9? |
| A: Chinese name of 352011-69-9 is 352011-69-9. |