dimethyl 1-methylnorcarane-7,7-dicarboxylate structure
|
Common Name | dimethyl 1-methylnorcarane-7,7-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 35207-80-8 | Molecular Weight | 226.26900 | |
| Density | 1.168g/cm3 | Boiling Point | 251.5ºC at 760 mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.2ºC | |
| Name | dimethyl 6-methylbicyclo[4.1.0]heptane-7,7-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 251.5ºC at 760 mmHg |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | 113.2ºC |
| Exact Mass | 226.12100 |
| PSA | 52.60000 |
| LogP | 1.52890 |
| Index of Refraction | 1.497 |
| InChIKey | XOYRKSABVYDICP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C(=O)OC)C2CCCCC21C |
| HS Code | 2917209090 |
|---|
|
~%
dimethyl 1-meth... CAS#:35207-80-8 |
| Literature: Wulfman,D.S. et al. Tetrahedron, 1976 , vol. 32, p. 1257 - 1265 |
|
~%
dimethyl 1-meth... CAS#:35207-80-8 |
| Literature: Peace,B.W. et al. Synthesis, 1971 , p. 658 - 661 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1-Methyl-7,7-dicarbomethoxynorcaran |