Setoglaucine structure
|
Common Name | Setoglaucine | ||
|---|---|---|---|---|
| CAS Number | 3521-06-0 | Molecular Weight | 399.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SetoglaucineSetoglaucine is a basic dye used to stain DNA. |
| Name | [4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H24Cl2N2 |
|---|---|
| Molecular Weight | 399.35600 |
| Exact Mass | 398.13200 |
| PSA | 6.25000 |
| LogP | 2.05100 |
| InChIKey | GRPFBMKYXAYEJM-UHFFFAOYSA-M |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2Cl)cc1.[Cl-] |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Setogalucine O |
| Setoglaucine |
| Rhoduline Blue |
| RHODULINE BLUE 6 G |
| Astrazon Blue G |
| Neusolidgruen 3 B |
| o-Chlor-malachitgruen |
| Primocyanine 6GX |
| 2-Chlor-4',4''-bis-dimethylamino-tritylium,Hydrochlorid |
| Setoglaucine O |
| 2-chloro-4',4''-bis-dimethylamino-tritylium,hydrochloride |
| Basic Blue G |
| Brilliant Basic Cyanine |
| Basic Blue DSC |
| Azure Blue G |
| Basic Blue 1 |
| EINECS 222-531-9 |
| Setoglaucin |