3,5,7-trihydroxy-6-methoxy-2-(4-methoxyphenyl)chromen-4-one structure
|
Common Name | 3,5,7-trihydroxy-6-methoxy-2-(4-methoxyphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 35214-88-1 | Molecular Weight | 330.28900 | |
| Density | 1.507g/cm3 | Boiling Point | 589.6ºC at 760mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.4ºC | |
| Name | 3,5,7-trihydroxy-6-methoxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 589.6ºC at 760mmHg |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.28900 |
| Flash Point | 220.4ºC |
| Exact Mass | 330.07400 |
| PSA | 109.36000 |
| LogP | 2.59400 |
| Index of Refraction | 1.681 |
| InChIKey | MSLBFGWANLXSOK-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2O)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 6-methoxy-4'-O-methylkaempferol |
| 3,5,7-trihydroxy-6,4-dimethoxyflavone |
| 6,4'-Dimethoxy-3,5,7-trihydroxyflavone |
| Betuletol |
| Beturetol |
| 4',6-dimethoxy-3,5,7-trihydroxyflavone |