(5Z)-5-(2-oxooxolan-3-ylidene)imidazolidine-2,4-dione structure
|
Common Name | (5Z)-5-(2-oxooxolan-3-ylidene)imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 35217-82-4 | Molecular Weight | 182.13400 | |
| Density | 1.612g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5Z)-5-(2-oxooxolan-3-ylidene)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.612g/cm3 |
|---|---|
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.13400 |
| Exact Mass | 182.03300 |
| PSA | 84.50000 |
| Index of Refraction | 1.599 |
| InChIKey | MBAHDQHEBHYEAF-ARJAWSKDSA-N |
| SMILES | O=C1NC(=O)C(=C2CCOC2=O)N1 |
|
~%
(5Z)-5-(2-oxoox... CAS#:35217-82-4 |
| Literature: Berlin,Y.Ya.; Korbukh,I.A. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1971 , vol. 7, p. 1202 - 1203 Khimiya Geterotsiklicheskikh Soedinenii, 1971 , vol. 7, p. 1280 - 1282 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(2-oxo-dihydro-furan-3-ylidene)-imidazolidine-2,4-dione |