Azidoethyl-SS-ethylazide structure
|
Common Name | Azidoethyl-SS-ethylazide | ||
|---|---|---|---|---|
| CAS Number | 352305-38-5 | Molecular Weight | 204.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H8N6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azidoethyl-SS-ethylazideAzidoethyl-SS-ethylazide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Azidoethyl-SS-ethylazide |
|---|
| Description | Azidoethyl-SS-ethylazide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C4H8N6S2 |
|---|---|
| Molecular Weight | 204.28 |
| InChIKey | SYKSDZXTWAVSIP-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCSSCCN=[N+]=[N-] |