5-bromo-3-[(5-bromo-3-carboxy-2-hydroxy-phenyl)methyl]-2-hydroxy-benzoic acid structure
|
Common Name | 5-bromo-3-[(5-bromo-3-carboxy-2-hydroxy-phenyl)methyl]-2-hydroxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35232-55-4 | Molecular Weight | 446.04400 | |
| Density | 1.999g/cm3 | Boiling Point | 612.9ºC at 760 mmHg | |
| Molecular Formula | C15H10Br2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.5ºC | |
| Name | 5-bromo-3-[(5-bromo-3-carboxy-2-hydroxyphenyl)methyl]-2-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.999g/cm3 |
|---|---|
| Boiling Point | 612.9ºC at 760 mmHg |
| Molecular Formula | C15H10Br2O6 |
| Molecular Weight | 446.04400 |
| Flash Point | 324.5ºC |
| Exact Mass | 443.88400 |
| PSA | 115.06000 |
| LogP | 3.61000 |
| Index of Refraction | 1.724 |
| InChIKey | LWQWHZWYCPLAKB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)cc(Cc2cc(Br)cc(C(=O)O)c2O)c1O |
|
Name: 50% cytotoxic concentrations for mock-infected MT-4 cells.
Source: ChEMBL
Target: MT4
External Id: CHEMBL708150
|
|
Name: Inhibitory concentration for cytopathicity of HIV-1 (HTLV-IIIB) in MT-4 cells
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL691384
|
|
Name: Inhibitory concentration for cytopathicity of HIV-1 (HTLV-IIIB) in CEM cells
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL691383
|
|
Name: Inhibition of PTP1B
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL905766
|
|
Name: Inhibitory concentration for cytopathicity of HIV-2 (LAV-2ROD) in MT-4 cells
Source: ChEMBL
Target: Human immunodeficiency virus 2
External Id: CHEMBL692463
|
| benzoic acid,3,3'-methylenebis[5-bromo-2-hydroxy |
| 5,5'-dibromo-3,3'-dicarboxy-2,2'-dihydroxydiphenylmethane |