3-(PYRIDIN-4-YL)-3,9-DIAZASPIRO[5.5]UNDECANE structure
|
Common Name | 3-(PYRIDIN-4-YL)-3,9-DIAZASPIRO[5.5]UNDECANE | ||
|---|---|---|---|---|
| CAS Number | 352445-70-6 | Molecular Weight | 231.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-pyridin-4-yl-3,9-diazaspiro[5.5]undecane |
|---|
| Molecular Formula | C14H21N3 |
|---|---|
| Molecular Weight | 231.33700 |
| Exact Mass | 231.17400 |
| PSA | 28.16000 |
| LogP | 2.44540 |
| InChIKey | UURPZDUBVYSYRO-UHFFFAOYSA-N |
| SMILES | c1cc(N2CCC3(CCNCC3)CC2)ccn1 |
| HS Code | 2933990090 |
|---|
|
~%
3-(PYRIDIN-4-YL... CAS#:352445-70-6 |
| Literature: GRUeNENTHAL GMBH; MERLA, Beatrix; OBERBOeRSCH, Stefan; REICH, Melanie; SCHUNK, Stefan; JOSTOCK, Ruth; HEES, Sabine; ENGELS, Michael; GERMANN, Tieno; BIJSTERVELD, Edward Patent: WO2010/99938 A1, 2010 ; Location in patent: Page/Page column 103-104 ; |
|
~%
3-(PYRIDIN-4-YL... CAS#:352445-70-6 |
| Literature: Smyth; Rose; Mehrotra; Heath; Ruhter; Schotten; Seroogy; Volkots; Pandey; Scarborough Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 10 p. 1289 - 1292 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |