3,5-dichlorobenzylzinc chloride structure
|
Common Name | 3,5-dichlorobenzylzinc chloride | ||
|---|---|---|---|---|
| CAS Number | 352530-34-8 | Molecular Weight | 260.85400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5Cl3Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dichlorobenzylzinc chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5Cl3Zn |
|---|---|
| Molecular Weight | 260.85400 |
| Exact Mass | 257.87500 |
| LogP | 3.99610 |
| InChIKey | RKQJHOLYOPZDBB-UHFFFAOYSA-M |
| SMILES | Cl[Zn+].[CH2-]c1cc(Cl)cc(Cl)c1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3,5-dichloro-benzyl zinc chloride |