1-Naphthalenamine, 8,8a(2)-azobis
Modify Date: 2026-07-03 19:30:03
1-Naphthalenamine, 8,8a(2)-azobis structure
|
Common Name | 1-Naphthalenamine, 8,8a(2)-azobis | ||
|---|---|---|---|---|
| CAS Number | 35264-39-2 | Molecular Weight | 312.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Naphthalenamine, 8,8a(2)-azobis |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H16N4 |
|---|---|
| Molecular Weight | 312.4 |
| InChIKey | OZBLZHYFPMCGEJ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2cccc(N=Nc3cccc4cccc(N)c34)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Naphthalenamine, 8,8a(2)-azobis? |
| A: InChIKey of 1-Naphthalenamine, 8,8a(2)-azobis is OZBLZHYFPMCGEJ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Naphthalenamine, 8,8a(2)-azobis? |
| A: The English name of 1-Naphthalenamine, 8,8a(2)-azobis is 1-Naphthalenamine, 8,8a(2)-azobis. |
| Q: What is the CAS number of 1-Naphthalenamine, 8,8a(2)-azobis? |
| A: CAS number of 1-Naphthalenamine, 8,8a(2)-azobis is 35264-39-2. |
| Q: What is the molecular weight of 1-Naphthalenamine, 8,8a(2)-azobis? |
| A: Molecular weight of 1-Naphthalenamine, 8,8a(2)-azobis is 312.4. |
| Q: What is the SMILES notation of 1-Naphthalenamine, 8,8a(2)-azobis? |
| A: SMILES notation of 1-Naphthalenamine, 8,8a(2)-azobis is Nc1cccc2cccc(N=Nc3cccc4cccc(N)c34)c12. |
| Q: What is the molecular formula of 1-Naphthalenamine, 8,8a(2)-azobis? |
| A: Molecular formula of 1-Naphthalenamine, 8,8a(2)-azobis is C20H16N4. |
| Q: What is the Chinese name of 35264-39-2? |
| A: Chinese name of 35264-39-2 is 35264-39-2. |