N-Methy-4-benzyloxy-3-methoxyphenethylamine Hydrochloride
Modify Date: 2025-09-18 09:07:33
N-Methy-4-benzyloxy-3-methoxyphenethylamine Hydrochloride structure
|
Common Name | N-Methy-4-benzyloxy-3-methoxyphenethylamine Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 35266-64-9 | Molecular Weight | 307.81500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methoxy-4-phenylmethoxyphenyl)-N-methylethanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H22ClNO2 |
|---|---|
| Molecular Weight | 307.81500 |
| Exact Mass | 307.13400 |
| PSA | 30.49000 |
| LogP | 4.22900 |
| InChIKey | IAPWNUJVKOZLNO-UHFFFAOYSA-N |
| SMILES | CNCCc1ccc(OCc2ccccc2)c(OC)c1.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| {2-[4-(benzyloxy)-3-methoxyphenyl]ethyl}(methyl)amine hydrochloride |
| N-Methyl-4-benzyloxy-3-methoxyphenethylamine hydrochloride |
| 3-Methoxy-N-methyl-4-(phenylmethoxy)benzeneethanamine Hydrochloride |
| 1-Benzyloxy-2-methoxy-4-(2-methylamino-aethyl)-benzol,Hydrochlorid |
| 4-BENZYLOXY-3-METHOXY-N-METHYLPHENETHYLAMINE HYDROCHLORIDE |
| N-Methy-4-benzyloxy-3-methoxyphenethylamine Hydrochloride |
| Benzeneethanamine,3-methoxy-N-methyl-4-(phenylmethoxy)-,hydrochloride (9CI) |
| 1-benzyloxy-2-methoxy-4-(2-methylamino-ethyl)-benzene,hydrochloride |