(R)-2-((tert-butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate structure
|
Common Name | (R)-2-((tert-butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 352705-03-4 | Molecular Weight | 329.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-2-((tert-butoxycarbonyl)amino)propyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23NO5S |
|---|---|
| Molecular Weight | 329.41200 |
| Exact Mass | 329.13000 |
| PSA | 90.08000 |
| LogP | 4.08520 |
| InChIKey | QUSKPZSSZRGCGD-LLVKDONJSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)C(C)NC(=O)OC(C)(C)C)cc1 |
| (R)-2-[(tert-butoxycarbonyl)amino]propyl toluene-4-sulphonate |
| (R)-N-(tert-butoxycarbonyl)-O-(4-methylsulfonyl)-2-aminopropanol |
| tosylate of (N-t-butoxycarbonyl-R-alaninol) |
| tosylate of (N-t-BOC-R-alaninol) |
| (R)-2-[(tert-butoxycarbonyl)amino]propyl toluene-4-sulphonate |