4,4-diphenylpiperidine-2,6-dione structure
|
Common Name | 4,4-diphenylpiperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 3531-30-4 | Molecular Weight | 265.30700 | |
| Density | 1.193g/cm3 | Boiling Point | 465.2ºC at 760 mmHg | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9ºC | |
| Name | 4,4-diphenylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 465.2ºC at 760 mmHg |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.30700 |
| Flash Point | 180.9ºC |
| Exact Mass | 265.11000 |
| PSA | 46.17000 |
| LogP | 2.73810 |
| Index of Refraction | 1.594 |
| InChIKey | PQTRIPOWYHNGPB-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)(c2ccccc2)CC(=O)N1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4-diphenyl-piperidine-2,6-dione |
| 4,4-Diphenyl-piperidin-2,6-dion |