N-ethyl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine structure
|
Common Name | N-ethyl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 35313-95-2 | Molecular Weight | 295.35700 | |
| Density | 1.237g/cm3 | Boiling Point | 436.5ºC at 760mmHg | |
| Molecular Formula | C13H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8ºC | |
| Name | N-ethyl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 436.5ºC at 760mmHg |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.35700 |
| Flash Point | 217.8ºC |
| Exact Mass | 295.09900 |
| PSA | 96.97000 |
| LogP | 2.08460 |
| Index of Refraction | 1.582 |
| InChIKey | OHISBGLPBCUMAJ-UHFFFAOYSA-N |
| SMILES | CCNc1nnc(-c2cc(OC)c(OC)c(OC)c2)s1 |
|
~82%
N-ethyl-5-(3,4,... CAS#:35313-95-2 |
| Literature: Mazzone; Bonina; Puglisi; Arrigo; Cosentino; Blandino Farmaco, Edizione Scientifica, 1982 , vol. 37, # 10 p. 685 - 700 |
|
~%
N-ethyl-5-(3,4,... CAS#:35313-95-2 |
| Literature: Al-Omar, Mohamed; Al-Deeb, Omar A.; Al-Khamees, Hamad A.; El-Emam, Ali A. Phosphorus, Sulfur and Silicon and the Related Elements, 2004 , vol. 179, # 12 p. 2509 - 2517 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |