3-(2-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid structure
|
Common Name | 3-(2-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 35318-44-6 | Molecular Weight | 337.25000 | |
| Density | 1.45g/cm3 | Boiling Point | 412.2ºC at 760 mmHg | |
| Molecular Formula | C16H10F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | 3-(2-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 412.2ºC at 760 mmHg |
| Molecular Formula | C16H10F3NO4 |
| Molecular Weight | 337.25000 |
| Flash Point | 203.1ºC |
| Exact Mass | 337.05600 |
| PSA | 83.12000 |
| LogP | 4.76200 |
| Index of Refraction | 1.604 |
| InChIKey | AGVDOKLGWOBWGX-LCYFTJDESA-N |
| SMILES | O=C(O)C(=Cc1ccccc1[N+](=O)[O-])c1ccc(C(F)(F)F)cc1 |
|
~%
3-(2-nitropheny... CAS#:35318-44-6 |
| Literature: Nodiff,E.A. et al. Journal of Medicinal Chemistry, 1971 , vol. 14, p. 921 - 925 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Nitro-4-trifluormethyl-phenylglycin-aethylester |
| ETHYL 2-(2-NITRO-4-TRIFLUOROMETHYLPHENYLAMINO)ACETATE |