Benzeneacetic acid, a-[(4-bromophenyl)methylene]-2-nitro-4-(trifluoromethyl)- structure
|
Common Name | Benzeneacetic acid, a-[(4-bromophenyl)methylene]-2-nitro-4-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 35318-47-9 | Molecular Weight | 416.14600 | |
| Density | 1.673g/cm3 | Boiling Point | 445.6ºC at 760 mmHg | |
| Molecular Formula | C16H9BrF3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | 3-(4-bromophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.673g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760 mmHg |
| Molecular Formula | C16H9BrF3NO4 |
| Molecular Weight | 416.14600 |
| Flash Point | 223.3ºC |
| Exact Mass | 414.96700 |
| PSA | 83.12000 |
| LogP | 5.52450 |
| Index of Refraction | 1.623 |
| InChIKey | BPSSBULAPGLOHN-QPEQYQDCSA-N |
| SMILES | O=C(O)C(=Cc1ccc(Br)cc1)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
|
~%
Benzeneacetic a... CAS#:35318-47-9 |
| Literature: Nodiff,E.A. et al. Journal of Medicinal Chemistry, 1971 , vol. 14, p. 921 - 925 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4'-Brom-2-methoxy-benzophenon |
| 4-BROMO-2'-METHOXYBENZOPHENONE |