Benzene,(2-nitro-1-nitrosoethyl)- structure
|
Common Name | Benzene,(2-nitro-1-nitrosoethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3532-83-0 | Molecular Weight | 180.16100 | |
| Density | 1.28g/cm3 | Boiling Point | 282.4ºC at 760mmHg | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.6ºC | |
| Name | (2-nitro-1-nitrosoethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 282.4ºC at 760mmHg |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16100 |
| Flash Point | 124.6ºC |
| Exact Mass | 180.05300 |
| PSA | 75.25000 |
| LogP | 2.29400 |
| Index of Refraction | 1.576 |
| InChIKey | HJVGFXVHUWSXNU-UHFFFAOYSA-N |
| SMILES | O=NC(C[N+](=O)[O-])c1ccccc1 |
|
~69%
Benzene,(2-nitr... CAS#:3532-83-0 |
| Literature: Shaabani, Ahmad; Bijanzadeh, Hamid Reza; Karimi, Ali Reza; Teimouri, Mohammad Bagher; Soleimani, Kamal Canadian Journal of Chemistry, 2008 , vol. 86, # 3 p. 248 - 252 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Styrolpseudonitrosit |
| (2-nitro-1-nitroso-ethyl)-benzene |
| 1-Nitroso-2-nitro-ethylbenzol |
| Benzene,(2-nitro-1-nitrosoethyl) |
| 1-Nitroso-2-nitro-1-phenylpropan |