N-(2-Hydroxypropyl)benzenesulphonamide
N-(2-Hydroxypropyl)benzenesulphonamide structure
|
Common Name | N-(2-Hydroxypropyl)benzenesulphonamide | ||
|---|---|---|---|---|
| CAS Number | 35325-02-1 | Molecular Weight | 215.26900 | |
| Density | 1.259g/cm3 | Boiling Point | 260ºC | |
| Molecular Formula | C9H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100ºC | |
Summary: N-(2-hydroxypropyl)benzenesulfonamide (CAS number: 35325-02-1) is a transparent colorless, viscous liquid with molecular formula C9H13NO3S and molecular weight 215.26900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-hydroxypropyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 260ºC |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.26900 |
| Flash Point | 100ºC |
| Exact Mass | 215.06200 |
| PSA | 74.78000 |
| LogP | 1.81740 |
| Index of Refraction | 1.552 |
| InChIKey | DHRXPBUFQGUINE-UHFFFAOYSA-N |
| SMILES | CC(O)CNS(=O)(=O)c1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(2-Hydroxypropyl)benzenesulphonamide |
| EINECS 252-512-0 |
| N-(2-oxidanylpropyl)benzenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: The English name of N-(2-hydroxypropyl)benzenesulfonamide is N-(2-hydroxypropyl)benzenesulfonamide. |
| Q: What is the LogP of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: LogP of N-(2-hydroxypropyl)benzenesulfonamide is 1.81740. |
| Q: What English synonyms does N-(2-hydroxypropyl)benzenesulfonamide have? |
| A: English synonyms of N-(2-hydroxypropyl)benzenesulfonamide: N-(2-Hydroxypropyl)benzenesulphonamide, EINECS 252-512-0, N-(2-oxidanylpropyl)benzenesulfonamide. |
| Q: What is the polar surface area (PSA) of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: Polar surface area (PSA) of N-(2-hydroxypropyl)benzenesulfonamide is 74.78000. |
| Q: What is the CAS number of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: CAS number of N-(2-hydroxypropyl)benzenesulfonamide is 35325-02-1. |
| Q: What is the boiling point of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: Boiling point of N-(2-hydroxypropyl)benzenesulfonamide is 260ºC. |
| Q: What is the SMILES notation of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: SMILES notation of N-(2-hydroxypropyl)benzenesulfonamide is CC(O)CNS(=O)(=O)c1ccccc1. |
| Q: What is the InChIKey of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: InChIKey of N-(2-hydroxypropyl)benzenesulfonamide is DHRXPBUFQGUINE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: Molecular weight of N-(2-hydroxypropyl)benzenesulfonamide is 215.26900. |
| Q: What is the molecular formula of N-(2-hydroxypropyl)benzenesulfonamide? |
| A: Molecular formula of N-(2-hydroxypropyl)benzenesulfonamide is C9H13NO3S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |