Benzamide, 2-amino-N-[4-(1-methylethyl)phenyl]- (9CI) structure
|
Common Name | Benzamide, 2-amino-N-[4-(1-methylethyl)phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 353255-15-9 | Molecular Weight | 254.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18N2O |
|---|---|
| Molecular Weight | 254.32700 |
| Exact Mass | 254.14200 |
| PSA | 55.12000 |
| LogP | 4.29870 |
| InChIKey | ZUWRVYUSVRFPPJ-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(NC(=O)c2ccccc2N)cc1 |
| HS Code | 2924299090 |
|---|
|
~87%
Benzamide, 2-am... CAS#:353255-15-9 |
| Literature: Petrov; Andreev Organic Preparations and Procedures International, 2005 , vol. 37, # 6 p. 560 - 565 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms550h20 |