6,8-Dichloro-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine structure
|
Common Name | 6,8-Dichloro-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 353258-21-6 | Molecular Weight | 293.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-Dichloro-2-(4-methoxyphenyl)imidazo[1,2-a]pyridine |
|---|
| Molecular Formula | C14H10Cl2N2O |
|---|---|
| Molecular Weight | 293.14800 |
| Exact Mass | 292.01700 |
| PSA | 26.53000 |
| LogP | 4.31670 |
| InChIKey | RMNFREBKIWMUCJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cn3cc(Cl)cc(Cl)c3n2)cc1 |
| HS Code | 2933990090 |
|---|
|
~72%
6,8-Dichloro-2-... CAS#:353258-21-6 |
| Literature: AUSTRALIAN NUCLEAR SCIENCE and TECHNOLOGY ORGANISATION Patent: WO2008/22396 A1, 2008 ; Location in patent: Page/Page column 44 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |