[1,1',3',1",3",1"'-Quaterphenyl]-3,3'''-dimethylalcohol structure
|
Common Name | [1,1',3',1",3",1"'-Quaterphenyl]-3,3'''-dimethylalcohol | ||
|---|---|---|---|---|
| CAS Number | 353289-47-1 | Molecular Weight | 366.45200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1,1',3',1",3",1"'-Quaterphenyl]-3,3'''-dimethylalcohol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H22O2 |
|---|---|
| Molecular Weight | 366.45200 |
| Exact Mass | 366.16200 |
| PSA | 40.46000 |
| LogP | 5.67220 |
| InChIKey | KIMHSAOJBYOCOQ-UHFFFAOYSA-N |
| SMILES | OCc1ccc(-c2cc(-c3ccc(CO)cc3)cc(-c3ccc(CO)cc3)c2)cc1 |
| HS Code | 2907299090 |
|---|
|
~99%
[1,1',3',1",3",... CAS#:353289-47-1 |
| Literature: Brunel; Ledoux; Zyss; Blanchard-Desce Chemical Communications, 2001 , # 10 p. 923 - 924 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 9,10-Bis(3-hydroxymethylphenyl)anthracene |
| 1,4-Di-(4-hydroxymethylphenyl)-naphthalene |
| 1,3,5-Tri(4-hydroxymethylphenyl)benzene |
| 1,4-Di-(3-hydroxymethylphenyl)-naphthalene |
| 2,3-DIHYDRO-6-HYDROXYMETHYL-(1H)-BENZO[IJ]QUINOLIZIN-5-ONE |
| 1,3,5-Tri(3-hydroxymethylphenyl)benzene |
| 1,3,5-tris(p-hydroxyphenyl)benzene |
| 3-(Anthracen-10-yl)benzyl alcohol |
| 2,4,6-Tri(3-hydroxymethylphenyl)-1,3,5-triazine |
| [1,3':1',1'':3'',1''':3''',1''''-Quinquephenyl]-3,3''''-dimethyl |