8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane structure
|
Common Name | 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane | ||
|---|---|---|---|---|
| CAS Number | 35331-58-9 | Molecular Weight | 336.68000 | |
| Density | 0.98g/cm3 | Boiling Point | 254.7ºC at 760mmHg | |
| Molecular Formula | C11H28O4Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.3ºC | |
| Name | 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane |
|---|
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 254.7ºC at 760mmHg |
| Molecular Formula | C11H28O4Si4 |
| Molecular Weight | 336.68000 |
| Flash Point | 96.3ºC |
| Exact Mass | 336.10600 |
| PSA | 36.92000 |
| LogP | 3.79790 |
| Index of Refraction | 1.446 |
| InChIKey | SYBBZMPRKQTWNE-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si]2(CCCCC2)O[Si](C)(C)O1 |
|
~%
8,8,10,10,12,12... CAS#:35331-58-9 |
| Literature: Andrianov,K.A. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1971 , vol. 20, p. 2172 - 2175 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1971 , vol. 20, p. 2300 - 2303 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |