8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane
![8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane Structure](https://image.chemsrc.com/caspic/485/35331-58-9.png)
8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane structure
|
Common Name | 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane | ||
|---|---|---|---|---|
| CAS Number | 35331-58-9 | Molecular Weight | 336.68000 | |
| Density | 0.98g/cm3 | Boiling Point | 254.7ºC at 760mmHg | |
| Molecular Formula | C11H28O4Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.3ºC | |
Summary: 8,8,10,10,12,12-Hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane (CAS: 35331-58-9, molecular formula: C11H28O4Si4, molecular weight: 336.68000), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 254.7ºC at 760mmHg |
| Molecular Formula | C11H28O4Si4 |
| Molecular Weight | 336.68000 |
| Flash Point | 96.3ºC |
| Exact Mass | 336.10600 |
| PSA | 36.92000 |
| LogP | 3.79790 |
| Index of Refraction | 1.446 |
| InChIKey | SYBBZMPRKQTWNE-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si]2(CCCCC2)O[Si](C)(C)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
8,8,10,10,12,12... CAS#:35331-58-9 |
| Literature: Andrianov,K.A. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1971 , vol. 20, p. 2172 - 2175 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1971 , vol. 20, p. 2300 - 2303 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: Polar surface area (PSA) of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is 36.92000. |
| Q: What is the boiling point of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: Boiling point of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is 254.7ºC at 760mmHg. |
| Q: What is the English name of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: The English name of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane. |
| Q: What is the LogP of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: LogP of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is 3.79790. |
| Q: What is the molecular formula of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: Molecular formula of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is C11H28O4Si4. |
| Q: What are the upstream materials of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: Related upstream materials(CAS) of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane: 18147-45-0;2401-73-2. |
| Q: What is the InChIKey of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: InChIKey of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is SYBBZMPRKQTWNE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: CAS number of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is 35331-58-9. |
| Q: What is the Chinese name of 35331-58-9? |
| A: Chinese name of 35331-58-9 is 35331-58-9. |
| Q: What is the molecular weight of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane? |
| A: Molecular weight of 8,8,10,10,12,12-hexamethyl-7,9,11,13-tetraoxa-6,8,10,12-tetrasilaspiro[5.7]tridecane is 336.68000. |