N-[chloro(phenyl)methyl]-N-propylcarbamoyl chloride structure
|
Common Name | N-[chloro(phenyl)methyl]-N-propylcarbamoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 35331-78-3 | Molecular Weight | 246.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[chloro(phenyl)methyl]-N-propylcarbamoyl chloride |
|---|
| Molecular Formula | C11H13Cl2NO |
|---|---|
| Molecular Weight | 246.13300 |
| Exact Mass | 245.03700 |
| PSA | 20.31000 |
| LogP | 3.99480 |
| InChIKey | BMEYWVVPVKNQEN-UHFFFAOYSA-N |
| SMILES | CCCN(C(=O)Cl)C(Cl)c1ccccc1 |
|
~%
N-[chloro(pheny... CAS#:35331-78-3 |
| Literature: Koyano,K. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 1872 - 1877 Full Text Show Details Kiefer,H. Synthesis, 1972 , p. 39 - 42 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |