ethyl 5-[(3,4-dichlorophenyl)carbamoyl]-2-hydroxybenzoate structure
|
Common Name | ethyl 5-[(3,4-dichlorophenyl)carbamoyl]-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 35334-01-1 | Molecular Weight | 354.18500 | |
| Density | 1.445g/cm3 | Boiling Point | 433.5ºC at 760 mmHg | |
| Molecular Formula | C16H13Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216ºC | |
| Name | ethyl 5-[(3,4-dichlorophenyl)carbamoyl]-2-hydroxybenzoate |
|---|
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760 mmHg |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.18500 |
| Flash Point | 216ºC |
| Exact Mass | 353.02200 |
| PSA | 79.12000 |
| LogP | 4.51200 |
| Index of Refraction | 1.645 |
| InChIKey | GETLFRAMDAGVEM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccc(Cl)c(Cl)c2)ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |