1-(((3,5-dibromo-2-hydroxybenzyl)(methyl)amino)methyl)-2-naphthol structure
|
Common Name | 1-(((3,5-dibromo-2-hydroxybenzyl)(methyl)amino)methyl)-2-naphthol | ||
|---|---|---|---|---|
| CAS Number | 3534-74-5 | Molecular Weight | 451.15200 | |
| Density | 1.67g/cm3 | Boiling Point | 521.4ºC at 760 mmHg | |
| Molecular Formula | C19H17Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.1ºC | |
| Name | 1-[[(3,5-dibromo-2-hydroxyphenyl)methyl-methylamino]methyl]naphthalen-2-ol |
|---|
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 521.4ºC at 760 mmHg |
| Molecular Formula | C19H17Br2NO2 |
| Molecular Weight | 451.15200 |
| Flash Point | 269.1ºC |
| Exact Mass | 448.96300 |
| PSA | 43.70000 |
| LogP | 5.40800 |
| Index of Refraction | 1.71 |
| InChIKey | MDGLBXLWXXWTIJ-UHFFFAOYSA-N |
| SMILES | CN(Cc1cc(Br)cc(Br)c1O)Cc1c(O)ccc2ccccc12 |
| HS Code | 2922509090 |
|---|
|
~78%
1-(((3,5-dibrom... CAS#:3534-74-5 |
| Literature: Woodgate, Paul D.; Horner, Gillian M.; Maynard, N. Paul; Rickard, Clifton E.F. Journal of Organometallic Chemistry, 1999 , vol. 592, # 2 p. 180 - 193 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |