4-chloro-2-[[(5-chloro-2-hydroxy-3-methyl-phenyl)methyl-methyl-amino]methyl]-6-methyl-phenol structure
|
Common Name | 4-chloro-2-[[(5-chloro-2-hydroxy-3-methyl-phenyl)methyl-methyl-amino]methyl]-6-methyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 3534-82-5 | Molecular Weight | 340.24400 | |
| Density | 1.308g/cm3 | Boiling Point | 451.1ºC at 760 mmHg | |
| Molecular Formula | C17H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.6ºC | |
| Name | 4-chloro-2-[[(5-chloro-2-hydroxy-3-methylphenyl)methyl-methylamino]methyl]-6-methylphenol |
|---|
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 451.1ºC at 760 mmHg |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.24400 |
| Flash Point | 226.6ºC |
| Exact Mass | 339.07900 |
| PSA | 43.70000 |
| LogP | 4.65340 |
| Index of Refraction | 1.624 |
| InChIKey | DBBYXNQYGOLGJV-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)cc(CN(C)Cc2cc(Cl)cc(C)c2O)c1O |
| HS Code | 2922299090 |
|---|
|
~%
4-chloro-2-[[(5... CAS#:3534-82-5 |
| Literature: Burke,W.J. et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 909 - 912 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |