1H-Imidazole,2-(4-chlorophenyl)-5-methyl- structure
|
Common Name | 1H-Imidazole,2-(4-chlorophenyl)-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 35345-09-6 | Molecular Weight | 192.64500 | |
| Density | 1.246g/cm3 | Boiling Point | 377.2ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | 2-(4-chlorophenyl)-4-methyl-3h-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 377.2ºC at 760 mmHg |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.64500 |
| Flash Point | 213.8ºC |
| Exact Mass | 192.04500 |
| PSA | 28.68000 |
| LogP | 3.03850 |
| Index of Refraction | 1.603 |
| InChIKey | PALVXRUKMAHOPW-UHFFFAOYSA-N |
| SMILES | Cc1cnc(-c2ccc(Cl)cc2)[nH]1 |
|
~28%
1H-Imidazole,2-... CAS#:35345-09-6 |
| Literature: Shen, Hao; Xie, Zuowei Journal of the American Chemical Society, 2010 , vol. 132, # 33 p. 11473 - 11480 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-chloro-phenyl)-4-methyl-1(3)H-imidazole |