2,2-diphenyl-N-(3-phenylpropyl)acetamide structure
|
Common Name | 2,2-diphenyl-N-(3-phenylpropyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 353471-19-9 | Molecular Weight | 329.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-diphenyl-N-(3-phenylpropyl)acetamide |
|---|
| Molecular Formula | C23H23NO |
|---|---|
| Molecular Weight | 329.4 |
| InChIKey | GGASESVHBWYDKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCNC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3 |
|
Name: Displacement of [3H]CP-55940 from human recombinant CB1 receptor expressed in HEK cel...
Source: ChEMBL
Target: Cannabinoid receptor 1
External Id: CHEMBL981122
|
|
Name: Displacement of [3H]CP-55940 from human recombinant CB2 receptor expressed in HEK cel...
Source: ChEMBL
Target: Cannabinoid receptor 2
External Id: CHEMBL981123
|