METHYL 4-ISOPROPOXY-3-METHOXYBENZOATE
METHYL 4-ISOPROPOXY-3-METHOXYBENZOATE structure
|
Common Name | METHYL 4-ISOPROPOXY-3-METHOXYBENZOATE | ||
|---|---|---|---|---|
| CAS Number | 3535-27-1 | Molecular Weight | 224.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-methoxy-4-propan-2-yloxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O4 |
|---|---|
| Molecular Weight | 224.25300 |
| Exact Mass | 224.10500 |
| PSA | 44.76000 |
| LogP | 2.26900 |
| InChIKey | DZPNABVYGJAIPV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC(C)C)c(OC)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| QC-1104 |
| 4-ISOPROPOXY-3-METHOXY-BENZOIC ACID METHYL ESTER |
| methyl 4-isopropoxy-3-methoxybenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: SMILES notation of methyl 3-methoxy-4-propan-2-yloxybenzoate is COC(=O)c1ccc(OC(C)C)c(OC)c1. |
| Q: What is the molecular formula of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: Molecular formula of methyl 3-methoxy-4-propan-2-yloxybenzoate is C12H16O4. |
| Q: What is the English name of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: The English name of methyl 3-methoxy-4-propan-2-yloxybenzoate is methyl 3-methoxy-4-propan-2-yloxybenzoate. |
| Q: What is the LogP of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: LogP of methyl 3-methoxy-4-propan-2-yloxybenzoate is 2.26900. |
| Q: What is the InChIKey of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: InChIKey of methyl 3-methoxy-4-propan-2-yloxybenzoate is DZPNABVYGJAIPV-UHFFFAOYSA-N. |
| Q: What is the CAS number of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: CAS number of methyl 3-methoxy-4-propan-2-yloxybenzoate is 3535-27-1. |
| Q: What is the polar surface area (PSA) of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: Polar surface area (PSA) of methyl 3-methoxy-4-propan-2-yloxybenzoate is 44.76000. |
| Q: What is the molecular weight of methyl 3-methoxy-4-propan-2-yloxybenzoate? |
| A: Molecular weight of methyl 3-methoxy-4-propan-2-yloxybenzoate is 224.25300. |
| Q: What English synonyms does methyl 3-methoxy-4-propan-2-yloxybenzoate have? |
| A: English synonyms of methyl 3-methoxy-4-propan-2-yloxybenzoate: QC-1104, 4-ISOPROPOXY-3-METHOXY-BENZOIC ACID METHYL ESTER, methyl 4-isopropoxy-3-methoxybenzoate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |