2-Methoxy-1,3-dinitrobenzene
2-Methoxy-1,3-dinitrobenzene structure
|
Common Name | 2-Methoxy-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 3535-67-9 | Molecular Weight | 198.133 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 340.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.3±24.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxy-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.1±22.0 °C at 760 mmHg |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.133 |
| Flash Point | 173.3±24.3 °C |
| Exact Mass | 198.027664 |
| PSA | 100.87000 |
| LogP | 1.26 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | DZVZPFZSAYLSDU-UHFFFAOYSA-N |
| SMILES | COc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-dinitroanisol |
| 2,6-Dinitroanisole |
| 2,6-Dinitrophenyl methyl ether |
| 2.6-Dinitro-1-methoxy-benzol |
| 2-Methoxy-1,3-dinitrobenzene |
| 2,6-dinitromethoxybenzene |
| Benzene,2-methoxy-1,3-dinitro |
| 2,6-Dinitro-1-methoxy-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-methoxy-1,3-dinitrobenzene? |
| A: InChIKey of 2-methoxy-1,3-dinitrobenzene is DZVZPFZSAYLSDU-UHFFFAOYSA-N. |
| Q: What is the English name of 2-methoxy-1,3-dinitrobenzene? |
| A: The English name of 2-methoxy-1,3-dinitrobenzene is 2-methoxy-1,3-dinitrobenzene. |
| Q: What is the polar surface area (PSA) of 2-methoxy-1,3-dinitrobenzene? |
| A: Polar surface area (PSA) of 2-methoxy-1,3-dinitrobenzene is 100.87000. |
| Q: What is the Chinese name of 3535-67-9? |
| A: Chinese name of 3535-67-9 is 3535-67-9. |
| Q: What is the SMILES notation of 2-methoxy-1,3-dinitrobenzene? |
| A: SMILES notation of 2-methoxy-1,3-dinitrobenzene is COc1c([N+](=O)[O-])cccc1[N+](=O)[O-]. |
| Q: What is the molecular formula of 2-methoxy-1,3-dinitrobenzene? |
| A: Molecular formula of 2-methoxy-1,3-dinitrobenzene is C7H6N2O5. |
| Q: What is the boiling point of 2-methoxy-1,3-dinitrobenzene? |
| A: Boiling point of 2-methoxy-1,3-dinitrobenzene is 340.1±22.0 °C at 760 mmHg. |
| Q: What is the CAS number of 2-methoxy-1,3-dinitrobenzene? |
| A: CAS number of 2-methoxy-1,3-dinitrobenzene is 3535-67-9. |
| Q: What is the molecular weight of 2-methoxy-1,3-dinitrobenzene? |
| A: Molecular weight of 2-methoxy-1,3-dinitrobenzene is 198.133. |
| Q: What English synonyms does 2-methoxy-1,3-dinitrobenzene have? |
| A: English synonyms of 2-methoxy-1,3-dinitrobenzene: 2,6-dinitroanisol, 2,6-Dinitroanisole, 2,6-Dinitrophenyl methyl ether, 2.6-Dinitro-1-methoxy-benzol, 2-Methoxy-1,3-dinitrobenzene, 2,6-dinitromethoxybenzene, Benzene,2-methoxy-1,3-dinitro, 2,6-Dinitro-1-methoxy-benzene. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |