6-(2-aminophenyl)-3-prop-2-enylsulfanyl-2H-1,2,4-triazin-5-one
Modify Date: 2025-09-04 21:18:51
6-(2-aminophenyl)-3-prop-2-enylsulfanyl-2H-1,2,4-triazin-5-one structure
|
Common Name | 6-(2-aminophenyl)-3-prop-2-enylsulfanyl-2H-1,2,4-triazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 353516-57-1 | Molecular Weight | 260.31500 | |
| Density | 1.36g/cm3 | Boiling Point | 413.3ºC at 760 mmHg | |
| Molecular Formula | C12H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | 6-(2-aminophenyl)-3-prop-2-enylsulfanyl-2H-1,2,4-triazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 413.3ºC at 760 mmHg |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.31500 |
| Flash Point | 203.7ºC |
| Exact Mass | 260.07300 |
| PSA | 110.22000 |
| LogP | 2.68570 |
| Index of Refraction | 1.683 |
| InChIKey | XOVJHOVIHOYRMH-UHFFFAOYSA-N |
| SMILES | C=CCSc1nnc(-c2ccccc2N)c(=O)[nH]1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| hms1380d22 |