7-(2-oxocyclohexyl)oxychromen-2-one structure
|
Common Name | 7-(2-oxocyclohexyl)oxychromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 35355-39-6 | Molecular Weight | 258.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(2-oxocyclohexyl)oxychromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.26900 |
| Exact Mass | 258.08900 |
| PSA | 56.51000 |
| LogP | 2.68350 |
| InChIKey | OMHVDZSJVYESCX-UHFFFAOYSA-N |
| SMILES | O=C1CCCCC1Oc1ccc2ccc(=O)oc2c1 |
|
~56%
7-(2-oxocyclohe... CAS#:35355-39-6 |
| Literature: Sicard, Renaud; Chen, Lu S.; Marsaioli, Anita J.; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2005 , vol. 347, # 7-8 p. 1041 - 1050 |
|
~64%
7-(2-oxocyclohe... CAS#:35355-39-6 |
| Literature: Rodighiero; Palumbo; Magno; et al. Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 5 p. 1405 - 1410 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| hms2850i12 |