2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate
Modify Date: 2026-08-02 11:54:47
![2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate Structure](https://www.chemsrc.com/extcaspic/215/35375-75-8.png)
2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate structure
|
Common Name | 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 35375-75-8 | Molecular Weight | 300.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17ClN2O4 |
|---|---|
| Molecular Weight | 300.74 |
| InChIKey | PXFDYVSOTVEYGD-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCNC(N)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate? |
| A: The English name of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate is 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate. |
| Q: What is the InChIKey of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate? |
| A: InChIKey of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate is PXFDYVSOTVEYGD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate? |
| A: Molecular weight of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate is 300.74. |
| Q: What is the CAS number of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate? |
| A: CAS number of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate is 35375-75-8. |
| Q: What is the Chinese name of 35375-75-8? |
| A: Chinese name of 35375-75-8 is 35375-75-8. |
| Q: What is the molecular formula of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate? |
| A: Molecular formula of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate is C13H17ClN2O4. |
| Q: What is the SMILES notation of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate? |
| A: SMILES notation of 2-[(Aminocarbonyl)amino]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate is CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCNC(N)=O. |