1-(4-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]methanamine structure
|
Common Name | 1-(4-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 353779-16-5 | Molecular Weight | 336.22400 | |
| Density | 1.313g/cm3 | Boiling Point | 410.5ºC at 760 mmHg | |
| Molecular Formula | C16H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | 1-(4-bromophenyl)-N-[(2,3-dimethoxyphenyl)methyl]methanamine |
|---|
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 410.5ºC at 760 mmHg |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.22400 |
| Flash Point | 202.1ºC |
| Exact Mass | 335.05200 |
| PSA | 30.49000 |
| LogP | 4.14700 |
| Index of Refraction | 1.577 |
| InChIKey | ZSUAEARDUIGVOI-UHFFFAOYSA-N |
| SMILES | COc1cccc(CNCc2ccc(Br)cc2)c1OC |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |