2-Nitrophenylalanine structure
|
Common Name | 2-Nitrophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 35378-63-3 | Molecular Weight | 210.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 385.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9±25.1 °C | |
| Name | 2-nitro-dl-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.4±32.0 °C at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.187 |
| Flash Point | 186.9±25.1 °C |
| Exact Mass | 210.064056 |
| PSA | 109.14000 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | SDZGVFSSLGTJAJ-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccccc1[N+](=O)[O-])C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| o-Nitro-phenylalanin |
| DL-o-Nitrophenylalanin |
| 2-Nitro-phenylalanin |
| 2-Nitrophenylb-D-thiogalactopyranoside |
| DL-2-nitrophenylalanine |
| O-NITROPHENYL 1-THIO-B-D-*GALACTOPYRANOS IDE |
| 2-Nitrophenyl 1-thio-B-D-galactopyranoside |
| RARECHEM AH BS 0066 |
| 2-Nitrophenylalanine |
| o-nitrophenylalanine |