(pentafluoro ethyl) trifluoro silane
(pentafluoro ethyl) trifluoro silane structure
|
Common Name | (pentafluoro ethyl) trifluoro silane | ||
|---|---|---|---|---|
| CAS Number | 354-89-2 | Molecular Weight | 204.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2F8Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (pentafluoro ethyl) trifluoro silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C2F8Si |
|---|---|
| Molecular Weight | 204.09400 |
| Exact Mass | 203.96400 |
| LogP | 2.99050 |
| InChIKey | TWCZVKDWAYHNSZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)[Si](F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 8 | |
CAS#:1516-65-0
CAS#:1516-64-9
CAS#:7783-61-1
CAS#:354-33-6
CAS#:360-89-4
CAS#:58734-91-1
CAS#:354-96-1
CAS#:432-04-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pentafluoraethyl-trifluorsilan |
| Trifluoro-(pentafluoroethyl)-silan |
| 1,1,1,2,2-Pentafluoro-2-trifluorsilicium-aethan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (pentafluoro ethyl) trifluoro silane? |
| A: The English name of (pentafluoro ethyl) trifluoro silane is (pentafluoro ethyl) trifluoro silane. |
| Q: What is the InChIKey of (pentafluoro ethyl) trifluoro silane? |
| A: InChIKey of (pentafluoro ethyl) trifluoro silane is TWCZVKDWAYHNSZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (pentafluoro ethyl) trifluoro silane? |
| A: Molecular formula of (pentafluoro ethyl) trifluoro silane is C2F8Si. |
| Q: What English synonyms does (pentafluoro ethyl) trifluoro silane have? |
| A: English synonyms of (pentafluoro ethyl) trifluoro silane: Pentafluoraethyl-trifluorsilan, Trifluoro-(pentafluoroethyl)-silan, 1,1,1,2,2-Pentafluoro-2-trifluorsilicium-aethan. |
| Q: What is the CAS number of (pentafluoro ethyl) trifluoro silane? |
| A: CAS number of (pentafluoro ethyl) trifluoro silane is 354-89-2. |
| Q: What is the LogP of (pentafluoro ethyl) trifluoro silane? |
| A: LogP of (pentafluoro ethyl) trifluoro silane is 2.99050. |
| Q: What is the molecular weight of (pentafluoro ethyl) trifluoro silane? |
| A: Molecular weight of (pentafluoro ethyl) trifluoro silane is 204.09400. |
| Q: What is the Chinese name of 354-89-2? |
| A: Chinese name of 354-89-2 is 354-89-2. |
| Q: What is the SMILES notation of (pentafluoro ethyl) trifluoro silane? |
| A: SMILES notation of (pentafluoro ethyl) trifluoro silane is FC(F)(F)C(F)(F)[Si](F)(F)F. |
| Q: What are the downstream products of (pentafluoro ethyl) trifluoro silane? |
| A: Related downstream products(CAS) of (pentafluoro ethyl) trifluoro silane: 1516-65-0;1516-64-9;7783-61-1;354-33-6;360-89-4;58734-91-1;354-96-1;432-04-2. |